About 2,6-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylmethoxy)aniline;dihydrochloride
2,6-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylmethoxy)aniline;dihydrochloride (PubChem CID 159061331) has the molecular formula C10H13Cl4N3O
and a molecular weight of 333.05 g/mol. Its IUPAC name is 2,6-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylmethoxy)aniline;dihydrochloride.
Molecular Properties
| Compound Name | 2,6-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylmethoxy)aniline;dihydrochloride |
| PubChem CID | 159061331 |
| Molecular Formula | C10H13Cl4N3O |
| Molecular Weight | 333.05 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 2,6-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylmethoxy)aniline;dihydrochloride |
| SMILES | Cl.Cl.Nc1c(Cl)cc(OCC2=NCCN2)cc1Cl |
| InChI | InChI=1S/C10H11Cl2N3O.2ClH/c11-7-3-6(4-8(12)10(7)13)16-5-9-14-1-2-15-9;;/h3-4H,1-2,5,13H2,(H,14,15);2*1H |
| InChIKey | JYMUDVGNSULKOS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.05 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylmethoxy)aniline;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylmethoxy)aniline;dihydrochloride?
The IUPAC name of 2,6-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylmethoxy)aniline;dihydrochloride (CID 159061331) is 2,6-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylmethoxy)aniline;dihydrochloride.
What is the SMILES notation for 2,6-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylmethoxy)aniline;dihydrochloride?
The canonical SMILES for 2,6-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylmethoxy)aniline;dihydrochloride is Cl.Cl.Nc1c(Cl)cc(OCC2=NCCN2)cc1Cl.
What is the InChIKey of 2,6-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylmethoxy)aniline;dihydrochloride?
The InChIKey is JYMUDVGNSULKOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl2N3O.2ClH/c11-7-3-6(4-8(12)10(7)13)16-5-9-14-1-2-15-9;;/h3-4H,1-2,5,13H2,(H,14,15);2*1H.
What are the key properties of 2,6-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylmethoxy)aniline;dihydrochloride?
2,6-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylmethoxy)aniline;dihydrochloride has a molecular weight of 333.05 g/mol, XLogP of 2.80, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylmethoxy)aniline;dihydrochloride is sourced from PubChem (CID 159061331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).