C46H64N2O2 — CID 15906154
2-[[benzyl-[2-[benzyl-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]amino]ethyl]amino]methyl]-4,6-ditert-butylphenol (PubChem CID 15906154) has the molecular formula C46H64N2O2 and a molecular weight of 677.03 g/mol. Its IUPAC name is 2-[[benzyl-[2-[benzyl-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]amino]ethyl]amino]methyl]-4,6-ditert-butylphenol.
| Compound Name | 2-[[benzyl-[2-[benzyl-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]amino]ethyl]amino]methyl]-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 15906154 |
| Molecular Formula | C46H64N2O2 |
| Molecular Weight | 677.03 g/mol |
| Exact Mass | 676.50 |
| IUPAC Name | 2-[[benzyl-[2-[benzyl-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]amino]ethyl]amino]methyl]-4,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(CN(CCN(Cc2ccccc2)Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)Cc2ccccc2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C46H64N2O2/c1-43(2,3)37-25-35(41(49)39(27-37)45(7,8)9)31-47(29-33-19-15-13-16-20-33)23-24-48(30-34-21-17-14-18-22-34)32-36-26-38(44(4,5)6)28-40(42(36)50)46(10,11)12/h13-22,25-28,49-50H,23-24,29-32H2,1-12H3 |
| InChIKey | MXRLMMHSVVMMSW-UHFFFAOYSA-N |
| XLogP | 10.99 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.03 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|