C14H23NO5S — CID 159062389
(5E,7E)-5-acetyl-8-(diethylamino)-4-oxoocta-5,7-diene-1-sulfonic acid (PubChem CID 159062389) has the molecular formula C14H23NO5S and a molecular weight of 317.41 g/mol. Its IUPAC name is (5E,7E)-5-acetyl-8-(diethylamino)-4-oxoocta-5,7-diene-1-sulfonic acid.
| Compound Name | (5E,7E)-5-acetyl-8-(diethylamino)-4-oxoocta-5,7-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 159062389 |
| Molecular Formula | C14H23NO5S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | (5E,7E)-5-acetyl-8-(diethylamino)-4-oxoocta-5,7-diene-1-sulfonic acid |
| SMILES | CCN(/C=C/C=C(\C(C)=O)C(=O)CCCS(=O)(=O)O)CC |
| InChI | InChI=1S/C14H23NO5S/c1-4-15(5-2)10-6-8-13(12(3)16)14(17)9-7-11-21(18,19)20/h6,8,10H,4-5,7,9,11H2,1-3H3,(H,18,19,20)/b10-6+,13-8+ |
| InChIKey | LLRIWGLLQMWZBP-FPGCMKNTSA-N |
| XLogP | 1.59 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|