C11H12F5NO5 — CID 159062739
oxalic acid;2,2,3,3,3-pentafluoro-1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)propan-1-one (PubChem CID 159062739) has the molecular formula C11H12F5NO5 and a molecular weight of 333.21 g/mol. Its IUPAC name is oxalic acid;2,2,3,3,3-pentafluoro-1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)propan-1-one.
| Compound Name | oxalic acid;2,2,3,3,3-pentafluoro-1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)propan-1-one |
|---|---|
| PubChem CID | 159062739 |
| Molecular Formula | C11H12F5NO5 |
| Molecular Weight | 333.21 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | oxalic acid;2,2,3,3,3-pentafluoro-1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)propan-1-one |
| SMILES | CN1CCC=C(C(=O)C(F)(F)C(F)(F)F)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C9H10F5NO.C2H2O4/c1-15-4-2-3-6(5-15)7(16)8(10,11)9(12,13)14;3-1(4)2(5)6/h3H,2,4-5H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | JYRDDNCQOHRJLM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|