C23H36O6Si — CID 159062981
(5R)-3-prop-2-enoxy-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-ol;(5R)-3-prop-2-enoxy-4-trimethylsilyl-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-ol (PubChem CID 159062981) has the molecular formula C23H36O6Si and a molecular weight of 436.62 g/mol. Its IUPAC name is (5R)-3-prop-2-enoxy-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-ol;(5R)-3-prop-2-enoxy-4-trimethylsilyl-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-ol.
| Compound Name | (5R)-3-prop-2-enoxy-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-ol;(5R)-3-prop-2-enoxy-4-trimethylsilyl-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-ol |
|---|---|
| PubChem CID | 159062981 |
| Molecular Formula | C23H36O6Si |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | (5R)-3-prop-2-enoxy-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-ol;(5R)-3-prop-2-enoxy-4-trimethylsilyl-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-ol |
| SMILES | C=CCOC1OCC2C[C@@H](O)C([Si](C)(C)C)=C21.C=CCOC1OCC2C[C@@H](O)C=C21 |
| InChI | InChI=1S/C13H22O3Si.C10H14O3/c1-5-6-15-13-11-9(8-16-13)7-10(14)12(11)17(2,3)4;1-2-3-12-10-9-5-8(11)4-7(9)6-13-10/h5,9-10,13-14H,1,6-8H2,2-4H3;2,5,7-8,10-11H,1,3-4,6H2/t9?,10-,13?;7?,8-,10?/m11/s1 |
| InChIKey | JYRZCAZTVSPAAH-AIKXFXTPSA-N |
| XLogP | 2.95 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|