C8H11N — CID 159062995
3-(3,3,4,4-tetradeuteriocyclopentyl)prop-2-enenitrile (PubChem CID 159062995) has the molecular formula C8H11N and a molecular weight of 125.21 g/mol. Its IUPAC name is 3-(3,3,4,4-tetradeuteriocyclopentyl)prop-2-enenitrile.
| Compound Name | 3-(3,3,4,4-tetradeuteriocyclopentyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 159062995 |
| Molecular Formula | C8H11N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.11 |
| IUPAC Name | 3-(3,3,4,4-tetradeuteriocyclopentyl)prop-2-enenitrile |
| SMILES | [2H]C1([2H])CC(C=CC#N)CC1([2H])[2H] |
| InChI | InChI=1S/C8H11N/c9-7-3-6-8-4-1-2-5-8/h3,6,8H,1-2,4-5H2/i1D2,2D2 |
| InChIKey | VMELXYJYSXXORF-LNLMKGTHSA-N |
| XLogP | 2.26 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|