About 9-acetyl-7,8-dihydro-3H-pyrimido[4,5-b]azepin-4-one
9-acetyl-7,8-dihydro-3H-pyrimido[4,5-b]azepin-4-one (PubChem CID 159064120) has the molecular formula C10H11N3O2
and a molecular weight of 205.22 g/mol. Its IUPAC name is 9-acetyl-7,8-dihydro-3H-pyrimido[4,5-b]azepin-4-one.
Molecular Properties
| Compound Name | 9-acetyl-7,8-dihydro-3H-pyrimido[4,5-b]azepin-4-one |
| PubChem CID | 159064120 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 9-acetyl-7,8-dihydro-3H-pyrimido[4,5-b]azepin-4-one |
| SMILES | CC(=O)N1CCC=Cc2c1nc[nH]c2=O |
| InChI | InChI=1S/C10H11N3O2/c1-7(14)13-5-3-2-4-8-9(13)11-6-12-10(8)15/h2,4,6H,3,5H2,1H3,(H,11,12,15) |
| InChIKey | JYVMZYGUQXDRFK-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-acetyl-7,8-dihydro-3H-pyrimido[4,5-b]azepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-acetyl-7,8-dihydro-3H-pyrimido[4,5-b]azepin-4-one?
The IUPAC name of 9-acetyl-7,8-dihydro-3H-pyrimido[4,5-b]azepin-4-one (CID 159064120) is 9-acetyl-7,8-dihydro-3H-pyrimido[4,5-b]azepin-4-one.
What is the SMILES notation for 9-acetyl-7,8-dihydro-3H-pyrimido[4,5-b]azepin-4-one?
The canonical SMILES for 9-acetyl-7,8-dihydro-3H-pyrimido[4,5-b]azepin-4-one is CC(=O)N1CCC=Cc2c1nc[nH]c2=O.
What is the InChIKey of 9-acetyl-7,8-dihydro-3H-pyrimido[4,5-b]azepin-4-one?
The InChIKey is JYVMZYGUQXDRFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2/c1-7(14)13-5-3-2-4-8-9(13)11-6-12-10(8)15/h2,4,6H,3,5H2,1H3,(H,11,12,15).
What are the key properties of 9-acetyl-7,8-dihydro-3H-pyrimido[4,5-b]azepin-4-one?
9-acetyl-7,8-dihydro-3H-pyrimido[4,5-b]azepin-4-one has a molecular weight of 205.22 g/mol, XLogP of 0.54, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-acetyl-7,8-dihydro-3H-pyrimido[4,5-b]azepin-4-one is sourced from PubChem (CID 159064120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).