C25H22F2N2O4 — CID 159065235
1-[2-[(4-fluorophenyl)methoxy]-5-(morpholine-4-carbonyl)phenyl]-2-(2-fluoro-3-pyridinyl)ethanone (PubChem CID 159065235) has the molecular formula C25H22F2N2O4 and a molecular weight of 452.46 g/mol. Its IUPAC name is 1-[2-[(4-fluorophenyl)methoxy]-5-(morpholine-4-carbonyl)phenyl]-2-(2-fluoro-3-pyridinyl)ethanone.
| Compound Name | 1-[2-[(4-fluorophenyl)methoxy]-5-(morpholine-4-carbonyl)phenyl]-2-(2-fluoro-3-pyridinyl)ethanone |
|---|---|
| PubChem CID | 159065235 |
| Molecular Formula | C25H22F2N2O4 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 1-[2-[(4-fluorophenyl)methoxy]-5-(morpholine-4-carbonyl)phenyl]-2-(2-fluoro-3-pyridinyl)ethanone |
| SMILES | O=C(Cc1cccnc1F)c1cc(C(=O)N2CCOCC2)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C25H22F2N2O4/c26-20-6-3-17(4-7-20)16-33-23-8-5-19(25(31)29-10-12-32-13-11-29)14-21(23)22(30)15-18-2-1-9-28-24(18)27/h1-9,14H,10-13,15-16H2 |
| InChIKey | JYYWSPARDIUXHL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|