C14H26N2O — CID 15906530
(1S,2S,4R)-1-methyl-2-piperazin-1-yl-4-prop-1-en-2-ylcyclohexan-1-ol (PubChem CID 15906530) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is (1S,2S,4R)-1-methyl-2-piperazin-1-yl-4-prop-1-en-2-ylcyclohexan-1-ol.
| Compound Name | (1S,2S,4R)-1-methyl-2-piperazin-1-yl-4-prop-1-en-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 15906530 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | (1S,2S,4R)-1-methyl-2-piperazin-1-yl-4-prop-1-en-2-ylcyclohexan-1-ol |
| SMILES | C=C(C)[C@@H]1CC[C@](C)(O)[C@@H](N2CCNCC2)C1 |
| InChI | InChI=1S/C14H26N2O/c1-11(2)12-4-5-14(3,17)13(10-12)16-8-6-15-7-9-16/h12-13,15,17H,1,4-10H2,2-3H3/t12-,13+,14+/m1/s1 |
| InChIKey | OIHSEHOHRXCGHW-RDBSUJKOSA-N |
| XLogP | 1.39 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|