About 3-(3-methoxy-1,2-benzothiazol-5-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione
3-(3-methoxy-1,2-benzothiazol-5-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 15906563) has the molecular formula C14H10F3N3O3S
and a molecular weight of 357.31 g/mol. Its IUPAC name is 3-(3-methoxy-1,2-benzothiazol-5-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 3-(3-methoxy-1,2-benzothiazol-5-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| PubChem CID | 15906563 |
| Molecular Formula | C14H10F3N3O3S |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 3-(3-methoxy-1,2-benzothiazol-5-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | COc1nsc2ccc(-n3c(=O)cc(C(F)(F)F)n(C)c3=O)cc12 |
| InChI | InChI=1S/C14H10F3N3O3S/c1-19-10(14(15,16)17)6-11(21)20(13(19)22)7-3-4-9-8(5-7)12(23-2)18-24-9/h3-6H,1-2H3 |
| InChIKey | HNIVFKICVNNYKT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(3-methoxy-1,2-benzothiazol-5-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methoxy-1,2-benzothiazol-5-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione?
The IUPAC name of 3-(3-methoxy-1,2-benzothiazol-5-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (CID 15906563) is 3-(3-methoxy-1,2-benzothiazol-5-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
What is the SMILES notation for 3-(3-methoxy-1,2-benzothiazol-5-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione?
The canonical SMILES for 3-(3-methoxy-1,2-benzothiazol-5-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione is COc1nsc2ccc(-n3c(=O)cc(C(F)(F)F)n(C)c3=O)cc12.
What is the InChIKey of 3-(3-methoxy-1,2-benzothiazol-5-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione?
The InChIKey is HNIVFKICVNNYKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F3N3O3S/c1-19-10(14(15,16)17)6-11(21)20(13(19)22)7-3-4-9-8(5-7)12(23-2)18-24-9/h3-6H,1-2H3.
What are the key properties of 3-(3-methoxy-1,2-benzothiazol-5-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione?
3-(3-methoxy-1,2-benzothiazol-5-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione has a molecular weight of 357.31 g/mol, XLogP of 2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methoxy-1,2-benzothiazol-5-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione is sourced from PubChem (CID 15906563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).