C42H62O6 — CID 159065646
[(1S,3R,7S,8S,8aR)-3,7-dimethyl-8-[2-[(2R,4R)-4-methyl-6-oxooxan-2-yl]ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate;3-octyl-3H-2-benzofuran-1-one (PubChem CID 159065646) has the molecular formula C42H62O6 and a molecular weight of 662.95 g/mol. Its IUPAC name is [(1S,3R,7S,8S,8aR)-3,7-dimethyl-8-[2-[(2R,4R)-4-methyl-6-oxooxan-2-yl]ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate;3-octyl-3H-2-benzofuran-1-one.
| Compound Name | [(1S,3R,7S,8S,8aR)-3,7-dimethyl-8-[2-[(2R,4R)-4-methyl-6-oxooxan-2-yl]ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate;3-octyl-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 159065646 |
| Molecular Formula | C42H62O6 |
| Molecular Weight | 662.95 g/mol |
| Exact Mass | 662.45 |
| IUPAC Name | [(1S,3R,7S,8S,8aR)-3,7-dimethyl-8-[2-[(2R,4R)-4-methyl-6-oxooxan-2-yl]ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate;3-octyl-3H-2-benzofuran-1-one |
| SMILES | CCC(C)(C)C(=O)O[C@H]1C[C@@H](C)C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](C)CC(=O)O3)[C@H]21.CCCCCCCCC1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C26H40O4.C16H22O2/c1-7-26(5,6)25(28)30-22-14-16(2)12-19-9-8-18(4)21(24(19)22)11-10-20-13-17(3)15-23(27)29-20;1-2-3-4-5-6-7-12-15-13-10-8-9-11-14(13)16(17)18-15/h8-9,12,16-18,20-22,24H,7,10-11,13-15H2,1-6H3;8-11,15H,2-7,12H2,1H3/t16-,17+,18-,20+,21-,22-,24-;/m0./s1 |
| InChIKey | JZACCTAYEDNKKQ-HJQPQSPVSA-N |
| XLogP | 10.51 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.95 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|