About bis(carbon dioxide);trimethyl-[methyl-(3-methylbutyl)-trimethylsilyloxysilyl]oxysilane
bis(carbon dioxide);trimethyl-[methyl-(3-methylbutyl)-trimethylsilyloxysilyl]oxysilane (PubChem CID 159066575) has the molecular formula C14H32O6Si3
and a molecular weight of 380.66 g/mol. Its IUPAC name is bis(carbon dioxide);trimethyl-[methyl-(3-methylbutyl)-trimethylsilyloxysilyl]oxysilane.
Molecular Properties
| Compound Name | bis(carbon dioxide);trimethyl-[methyl-(3-methylbutyl)-trimethylsilyloxysilyl]oxysilane |
| PubChem CID | 159066575 |
| Molecular Formula | C14H32O6Si3 |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | bis(carbon dioxide);trimethyl-[methyl-(3-methylbutyl)-trimethylsilyloxysilyl]oxysilane |
| SMILES | CC(C)CC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C.O=C=O.O=C=O |
| InChI | InChI=1S/C12H32O2Si3.2CO2/c1-12(2)10-11-17(9,13-15(3,4)5)14-16(6,7)8;2*2-1-3/h12H,10-11H2,1-9H3;; |
| InChIKey | JZCZFDASMGMKPD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(carbon dioxide);trimethyl-[methyl-(3-methylbutyl)-trimethylsilyloxysilyl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(carbon dioxide);trimethyl-[methyl-(3-methylbutyl)-trimethylsilyloxysilyl]oxysilane?
The IUPAC name of bis(carbon dioxide);trimethyl-[methyl-(3-methylbutyl)-trimethylsilyloxysilyl]oxysilane (CID 159066575) is bis(carbon dioxide);trimethyl-[methyl-(3-methylbutyl)-trimethylsilyloxysilyl]oxysilane.
What is the SMILES notation for bis(carbon dioxide);trimethyl-[methyl-(3-methylbutyl)-trimethylsilyloxysilyl]oxysilane?
The canonical SMILES for bis(carbon dioxide);trimethyl-[methyl-(3-methylbutyl)-trimethylsilyloxysilyl]oxysilane is CC(C)CC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C.O=C=O.O=C=O.
What is the InChIKey of bis(carbon dioxide);trimethyl-[methyl-(3-methylbutyl)-trimethylsilyloxysilyl]oxysilane?
The InChIKey is JZCZFDASMGMKPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H32O2Si3.2CO2/c1-12(2)10-11-17(9,13-15(3,4)5)14-16(6,7)8;2*2-1-3/h12H,10-11H2,1-9H3;;.
What are the key properties of bis(carbon dioxide);trimethyl-[methyl-(3-methylbutyl)-trimethylsilyloxysilyl]oxysilane?
bis(carbon dioxide);trimethyl-[methyl-(3-methylbutyl)-trimethylsilyloxysilyl]oxysilane has a molecular weight of 380.66 g/mol, XLogP of 3.64, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(carbon dioxide);trimethyl-[methyl-(3-methylbutyl)-trimethylsilyloxysilyl]oxysilane is sourced from PubChem (CID 159066575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).