C19H37ClO5Si2 — CID 159067070
(6aR,8S,9aS)-9-chloro-8-methyl-2,2,4,4-tetra(propan-2-yl)-6,6a,8,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocine-9-carbaldehyde (PubChem CID 159067070) has the molecular formula C19H37ClO5Si2 and a molecular weight of 437.13 g/mol. Its IUPAC name is (6aR,8S,9aS)-9-chloro-8-methyl-2,2,4,4-tetra(propan-2-yl)-6,6a,8,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocine-9-carbaldehyde.
| Compound Name | (6aR,8S,9aS)-9-chloro-8-methyl-2,2,4,4-tetra(propan-2-yl)-6,6a,8,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocine-9-carbaldehyde |
|---|---|
| PubChem CID | 159067070 |
| Molecular Formula | C19H37ClO5Si2 |
| Molecular Weight | 437.13 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (6aR,8S,9aS)-9-chloro-8-methyl-2,2,4,4-tetra(propan-2-yl)-6,6a,8,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocine-9-carbaldehyde |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@H](C)C(Cl)(C=O)[C@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C19H37ClO5Si2/c1-12(2)26(13(3)4)22-10-17-18(19(20,11-21)16(9)23-17)24-27(25-26,14(5)6)15(7)8/h11-18H,10H2,1-9H3/t16-,17+,18-,19?/m0/s1 |
| InChIKey | XOHRCMVDUIGCTH-TUVJXNFZSA-N |
| XLogP | 4.91 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.13 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|