C34H36N6O2 — CID 15906970
2-benzyl-N,N'-bis[2-(quinolin-2-ylmethylamino)ethyl]propanediamide (PubChem CID 15906970) has the molecular formula C34H36N6O2 and a molecular weight of 560.70 g/mol. Its IUPAC name is 2-benzyl-N,N'-bis[2-(quinolin-2-ylmethylamino)ethyl]propanediamide.
| Compound Name | 2-benzyl-N,N'-bis[2-(quinolin-2-ylmethylamino)ethyl]propanediamide |
|---|---|
| PubChem CID | 15906970 |
| Molecular Formula | C34H36N6O2 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | 2-benzyl-N,N'-bis[2-(quinolin-2-ylmethylamino)ethyl]propanediamide |
| SMILES | O=C(NCCNCc1ccc2ccccc2n1)C(Cc1ccccc1)C(=O)NCCNCc1ccc2ccccc2n1 |
| InChI | InChI=1S/C34H36N6O2/c41-33(37-20-18-35-23-28-16-14-26-10-4-6-12-31(26)39-28)30(22-25-8-2-1-3-9-25)34(42)38-21-19-36-24-29-17-15-27-11-5-7-13-32(27)40-29/h1-17,30,35-36H,18-24H2,(H,37,41)(H,38,42) |
| InChIKey | VCQKPCVEZURPFA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|