C21H30B2O16P2-2 — CID 159070075
CID 159070075 (PubChem CID 159070075) has the molecular formula C21H30B2O16P2-2 and a molecular weight of 622.03 g/mol.
| Compound Name | CID 159070075 |
|---|---|
| PubChem CID | 159070075 |
| Molecular Formula | C21H30B2O16P2-2 |
| Molecular Weight | 622.03 g/mol |
| Exact Mass | 622.12 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@@]2(COP(=O)([O-])OC3[C@@H]4OC[C@]3(COC)O[C@H]4[B])CO[C@H]1C2OP(=O)([O-])OC[C@]12CO[C@@H](C1OC)[C@H](C)O2 |
| InChI | InChI=1S/C21H32B2O16P2/c1-10-11-14(29-3)20(35-10,6-30-11)8-33-40(24,25)39-16-13-18(23)37-21(16,7-32-13)9-34-41(26,27)38-15-12-17(22)36-19(15,4-28-2)5-31-12/h10-18H,4-9H2,1-3H3,(H,24,25)(H,26,27)/p-2/t10-,11+,12-,13-,14?,15?,16?,17+,18+,19-,20+,21+/m0/s1 |
| InChIKey | FBOQYFSKUCSWNJ-DLZPQGDTSA-L |
| XLogP | -2.73 |
| TPSA | 191.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.03 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|