C23H24FeO2 — CID 159070812
cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylidene-6-(3-methylphenyl)-6-oxohexan-1-olate;iron(2+) (PubChem CID 159070812) has the molecular formula C23H24FeO2 and a molecular weight of 388.29 g/mol. Its IUPAC name is cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylidene-6-(3-methylphenyl)-6-oxohexan-1-olate;iron(2+).
| Compound Name | cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylidene-6-(3-methylphenyl)-6-oxohexan-1-olate;iron(2+) |
|---|---|
| PubChem CID | 159070812 |
| Molecular Formula | C23H24FeO2 |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylidene-6-(3-methylphenyl)-6-oxohexan-1-olate;iron(2+) |
| SMILES | Cc1cccc(C(=O)CCCCC([O-])=C2C=CC=C2)c1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C18H20O2.C5H5.Fe/c1-14-7-6-10-16(13-14)18(20)12-5-4-11-17(19)15-8-2-3-9-15;1-2-4-5-3-1;/h2-3,6-10,13,19H,4-5,11-12H2,1H3;1-5H;/q;-1;+2/p-1 |
| InChIKey | QHXOUOKMRQVXQO-UHFFFAOYSA-M |
| XLogP | 4.88 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|