C13H28O4S3 — CID 159071164
3-(3-hydroperoxy-2,2-dimethylpropyl)sulfanylcarbothioylsulfanyl-2,2-dimethylpropanoic acid;methane (PubChem CID 159071164) has the molecular formula C13H28O4S3 and a molecular weight of 344.56 g/mol. Its IUPAC name is 3-(3-hydroperoxy-2,2-dimethylpropyl)sulfanylcarbothioylsulfanyl-2,2-dimethylpropanoic acid;methane.
| Compound Name | 3-(3-hydroperoxy-2,2-dimethylpropyl)sulfanylcarbothioylsulfanyl-2,2-dimethylpropanoic acid;methane |
|---|---|
| PubChem CID | 159071164 |
| Molecular Formula | C13H28O4S3 |
| Molecular Weight | 344.56 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 3-(3-hydroperoxy-2,2-dimethylpropyl)sulfanylcarbothioylsulfanyl-2,2-dimethylpropanoic acid;methane |
| SMILES | C.C.CC(C)(COO)CSC(=S)SCC(C)(C)C(=O)O |
| InChI | InChI=1S/C11H20O4S3.2CH4/c1-10(2,5-15-14)6-17-9(16)18-7-11(3,4)8(12)13;;/h14H,5-7H2,1-4H3,(H,12,13);2*1H4 |
| InChIKey | JZQXGTHLXSJTGJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|