About sodium;chromium(3+);phosphonato phosphate
sodium;chromium(3+);phosphonato phosphate (PubChem CID 159071425) has the molecular formula CrNaO7P2
and a molecular weight of 248.93 g/mol. Its IUPAC name is sodium;chromium(3+);phosphonato phosphate.
Molecular Properties
| Compound Name | sodium;chromium(3+);phosphonato phosphate |
| PubChem CID | 159071425 |
| Molecular Formula | CrNaO7P2 |
| Molecular Weight | 248.93 g/mol |
| Exact Mass | 248.84 |
| IUPAC Name | sodium;chromium(3+);phosphonato phosphate |
| SMILES | O=P([O-])([O-])OP(=O)([O-])[O-].[Cr+3].[Na+] |
| InChI | InChI=1S/Cr.Na.H4O7P2/c;;1-8(2,3)7-9(4,5)6/h;;(H2,1,2,3)(H2,4,5,6)/q+3;+1;/p-4 |
| InChIKey | BDEIGBZHXPHRHB-UHFFFAOYSA-J |
| XLogP | -6.34 |
| TPSA | 135.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.93 |
| LogP ≤ 5 | -6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;chromium(3+);phosphonato phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;chromium(3+);phosphonato phosphate?
The IUPAC name of sodium;chromium(3+);phosphonato phosphate (CID 159071425) is sodium;chromium(3+);phosphonato phosphate.
What is the SMILES notation for sodium;chromium(3+);phosphonato phosphate?
The canonical SMILES for sodium;chromium(3+);phosphonato phosphate is O=P([O-])([O-])OP(=O)([O-])[O-].[Cr+3].[Na+].
What is the InChIKey of sodium;chromium(3+);phosphonato phosphate?
The InChIKey is BDEIGBZHXPHRHB-UHFFFAOYSA-J. The full InChI is InChI=1S/Cr.Na.H4O7P2/c;;1-8(2,3)7-9(4,5)6/h;;(H2,1,2,3)(H2,4,5,6)/q+3;+1;/p-4.
What are the key properties of sodium;chromium(3+);phosphonato phosphate?
sodium;chromium(3+);phosphonato phosphate has a molecular weight of 248.93 g/mol, XLogP of -6.34, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;chromium(3+);phosphonato phosphate is sourced from PubChem (CID 159071425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).