C19H20F2N2O3 — CID 159071778
N-tert-butyl-2-[5-[2-(3,4-difluorophenyl)acetyl]-1-methylpyrrol-3-yl]-2-oxoacetamide (PubChem CID 159071778) has the molecular formula C19H20F2N2O3 and a molecular weight of 362.38 g/mol. Its IUPAC name is N-tert-butyl-2-[5-[2-(3,4-difluorophenyl)acetyl]-1-methylpyrrol-3-yl]-2-oxoacetamide.
| Compound Name | N-tert-butyl-2-[5-[2-(3,4-difluorophenyl)acetyl]-1-methylpyrrol-3-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 159071778 |
| Molecular Formula | C19H20F2N2O3 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-tert-butyl-2-[5-[2-(3,4-difluorophenyl)acetyl]-1-methylpyrrol-3-yl]-2-oxoacetamide |
| SMILES | Cn1cc(C(=O)C(=O)NC(C)(C)C)cc1C(=O)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H20F2N2O3/c1-19(2,3)22-18(26)17(25)12-9-15(23(4)10-12)16(24)8-11-5-6-13(20)14(21)7-11/h5-7,9-10H,8H2,1-4H3,(H,22,26) |
| InChIKey | WTLIINPCWJQIFS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|