C13H23NO — CID 159072457
2,3-di(propan-2-yl)pyridine;ethanol (PubChem CID 159072457) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 2,3-di(propan-2-yl)pyridine;ethanol.
| Compound Name | 2,3-di(propan-2-yl)pyridine;ethanol |
|---|---|
| PubChem CID | 159072457 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 2,3-di(propan-2-yl)pyridine;ethanol |
| SMILES | CC(C)c1cccnc1C(C)C.CCO |
| InChI | InChI=1S/C11H17N.C2H6O/c1-8(2)10-6-5-7-12-11(10)9(3)4;1-2-3/h5-9H,1-4H3;3H,2H2,1H3 |
| InChIKey | JZVJTTXJGXYKKH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |