C20H27N3O9S3 — CID 159072804
2,3-dimethyl-3-(4-sulfobutyl)indole-5-sulfonic acid;4-hydrazinylbenzenesulfonic acid (PubChem CID 159072804) has the molecular formula C20H27N3O9S3 and a molecular weight of 549.65 g/mol. Its IUPAC name is 2,3-dimethyl-3-(4-sulfobutyl)indole-5-sulfonic acid;4-hydrazinylbenzenesulfonic acid.
| Compound Name | 2,3-dimethyl-3-(4-sulfobutyl)indole-5-sulfonic acid;4-hydrazinylbenzenesulfonic acid |
|---|---|
| PubChem CID | 159072804 |
| Molecular Formula | C20H27N3O9S3 |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | 2,3-dimethyl-3-(4-sulfobutyl)indole-5-sulfonic acid;4-hydrazinylbenzenesulfonic acid |
| SMILES | CC1=Nc2ccc(S(=O)(=O)O)cc2C1(C)CCCCS(=O)(=O)O.NNc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C14H19NO6S2.C6H8N2O3S/c1-10-14(2,7-3-4-8-22(16,17)18)12-9-11(23(19,20)21)5-6-13(12)15-10;7-8-5-1-3-6(4-2-5)12(9,10)11/h5-6,9H,3-4,7-8H2,1-2H3,(H,16,17,18)(H,19,20,21);1-4,8H,7H2,(H,9,10,11) |
| InChIKey | JZWOAMIAESCJEW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 213.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|