C31H35N7O2 — CID 159074845
1-[3-[6-[3-(4-methylpiperazin-1-yl)anilino]-1-(oxan-2-yl)pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one (PubChem CID 159074845) has the molecular formula C31H35N7O2 and a molecular weight of 537.67 g/mol. Its IUPAC name is 1-[3-[6-[3-(4-methylpiperazin-1-yl)anilino]-1-(oxan-2-yl)pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one.
| Compound Name | 1-[3-[6-[3-(4-methylpiperazin-1-yl)anilino]-1-(oxan-2-yl)pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 159074845 |
| Molecular Formula | C31H35N7O2 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | 1-[3-[6-[3-(4-methylpiperazin-1-yl)anilino]-1-(oxan-2-yl)pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cccc(-c2nc(Nc3cccc(N4CCN(C)CC4)c3)nc3c2cnn3C2CCCCO2)c1 |
| InChI | InChI=1S/C31H35N7O2/c1-3-26(39)19-22-8-6-9-23(18-22)29-27-21-32-38(28-12-4-5-17-40-28)30(27)35-31(34-29)33-24-10-7-11-25(20-24)37-15-13-36(2)14-16-37/h3,6-11,18,20-21,28H,1,4-5,12-17,19H2,2H3,(H,33,34,35) |
| InChIKey | SFBCRBPTTIPYDP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|