About 5-(4-methylpentoxy)-2-[(2-methylpropylamino)methyl]pentanoic acid;molecular hydrogen
5-(4-methylpentoxy)-2-[(2-methylpropylamino)methyl]pentanoic acid;molecular hydrogen (PubChem CID 159075229) has the molecular formula C16H35NO3
and a molecular weight of 289.46 g/mol. Its IUPAC name is 5-(4-methylpentoxy)-2-[(2-methylpropylamino)methyl]pentanoic acid;molecular hydrogen.
Molecular Properties
| Compound Name | 5-(4-methylpentoxy)-2-[(2-methylpropylamino)methyl]pentanoic acid;molecular hydrogen |
| PubChem CID | 159075229 |
| Molecular Formula | C16H35NO3 |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.26 |
| IUPAC Name | 5-(4-methylpentoxy)-2-[(2-methylpropylamino)methyl]pentanoic acid;molecular hydrogen |
| SMILES | CC(C)CCCOCCCC(CNCC(C)C)C(=O)O.[H][H] |
| InChI | InChI=1S/C16H33NO3.H2/c1-13(2)7-5-9-20-10-6-8-15(16(18)19)12-17-11-14(3)4;/h13-15,17H,5-12H2,1-4H3,(H,18,19);1H |
| InChIKey | KADZRHSPZGMELL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-methylpentoxy)-2-[(2-methylpropylamino)methyl]pentanoic acid;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methylpentoxy)-2-[(2-methylpropylamino)methyl]pentanoic acid;molecular hydrogen?
The IUPAC name of 5-(4-methylpentoxy)-2-[(2-methylpropylamino)methyl]pentanoic acid;molecular hydrogen (CID 159075229) is 5-(4-methylpentoxy)-2-[(2-methylpropylamino)methyl]pentanoic acid;molecular hydrogen.
What is the SMILES notation for 5-(4-methylpentoxy)-2-[(2-methylpropylamino)methyl]pentanoic acid;molecular hydrogen?
The canonical SMILES for 5-(4-methylpentoxy)-2-[(2-methylpropylamino)methyl]pentanoic acid;molecular hydrogen is CC(C)CCCOCCCC(CNCC(C)C)C(=O)O.[H][H].
What is the InChIKey of 5-(4-methylpentoxy)-2-[(2-methylpropylamino)methyl]pentanoic acid;molecular hydrogen?
The InChIKey is KADZRHSPZGMELL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33NO3.H2/c1-13(2)7-5-9-20-10-6-8-15(16(18)19)12-17-11-14(3)4;/h13-15,17H,5-12H2,1-4H3,(H,18,19);1H.
What are the key properties of 5-(4-methylpentoxy)-2-[(2-methylpropylamino)methyl]pentanoic acid;molecular hydrogen?
5-(4-methylpentoxy)-2-[(2-methylpropylamino)methyl]pentanoic acid;molecular hydrogen has a molecular weight of 289.46 g/mol, XLogP of 3.41, 13 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methylpentoxy)-2-[(2-methylpropylamino)methyl]pentanoic acid;molecular hydrogen is sourced from PubChem (CID 159075229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).