About 2-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]acetonitrile
2-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]acetonitrile (PubChem CID 15907586) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]acetonitrile |
| PubChem CID | 15907586 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]acetonitrile |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2CC#N |
| InChI | InChI=1S/C11H16N2/c1-2-9-8-13-6-4-10(9)7-11(13)3-5-12/h2,9-11H,1,3-4,6-8H2/t9-,10-,11+/m0/s1 |
| InChIKey | XGCRJWSGHBCYTN-GARJFASQSA-N |
| XLogP | 1.80 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]acetonitrile?
The IUPAC name of 2-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]acetonitrile (CID 15907586) is 2-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]acetonitrile.
What is the SMILES notation for 2-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]acetonitrile?
The canonical SMILES for 2-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]acetonitrile is C=C[C@H]1CN2CC[C@H]1C[C@H]2CC#N.
What is the InChIKey of 2-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]acetonitrile?
The InChIKey is XGCRJWSGHBCYTN-GARJFASQSA-N. The full InChI is InChI=1S/C11H16N2/c1-2-9-8-13-6-4-10(9)7-11(13)3-5-12/h2,9-11H,1,3-4,6-8H2/t9-,10-,11+/m0/s1.
What are the key properties of 2-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]acetonitrile?
2-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]acetonitrile has a molecular weight of 176.26 g/mol, XLogP of 1.80, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]acetonitrile is sourced from PubChem (CID 15907586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).