C18H26ClN3O5S — CID 159076123
4-[2-chloro-3-(3-methoxypropylamino)-4-methylsulfonylbenzoyl]-2,5-dimethyl-1H-pyrazol-3-one;methane (PubChem CID 159076123) has the molecular formula C18H26ClN3O5S and a molecular weight of 431.94 g/mol. Its IUPAC name is 4-[2-chloro-3-(3-methoxypropylamino)-4-methylsulfonylbenzoyl]-2,5-dimethyl-1H-pyrazol-3-one;methane.
| Compound Name | 4-[2-chloro-3-(3-methoxypropylamino)-4-methylsulfonylbenzoyl]-2,5-dimethyl-1H-pyrazol-3-one;methane |
|---|---|
| PubChem CID | 159076123 |
| Molecular Formula | C18H26ClN3O5S |
| Molecular Weight | 431.94 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 4-[2-chloro-3-(3-methoxypropylamino)-4-methylsulfonylbenzoyl]-2,5-dimethyl-1H-pyrazol-3-one;methane |
| SMILES | C.COCCCNc1c(S(C)(=O)=O)ccc(C(=O)c2c(C)[nH]n(C)c2=O)c1Cl |
| InChI | InChI=1S/C17H22ClN3O5S.CH4/c1-10-13(17(23)21(2)20-10)16(22)11-6-7-12(27(4,24)25)15(14(11)18)19-8-5-9-26-3;/h6-7,19-20H,5,8-9H2,1-4H3;1H4 |
| InChIKey | WTMMQKVHOWPHEN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.94 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|