About (2R)-2-butyl-2-ethylaziridine;sulfurochloridic acid
(2R)-2-butyl-2-ethylaziridine;sulfurochloridic acid (PubChem CID 159076460) has the molecular formula C8H18ClNO3S
and a molecular weight of 243.76 g/mol. Its IUPAC name is (2R)-2-butyl-2-ethylaziridine;sulfurochloridic acid.
Molecular Properties
| Compound Name | (2R)-2-butyl-2-ethylaziridine;sulfurochloridic acid |
| PubChem CID | 159076460 |
| Molecular Formula | C8H18ClNO3S |
| Molecular Weight | 243.76 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (2R)-2-butyl-2-ethylaziridine;sulfurochloridic acid |
| SMILES | CCCC[C@]1(CC)CN1.O=S(=O)(O)Cl |
| InChI | InChI=1S/C8H17N.ClHO3S/c1-3-5-6-8(4-2)7-9-8;1-5(2,3)4/h9H,3-7H2,1-2H3;(H,2,3,4)/t8-;/m1./s1 |
| InChIKey | KAHSQIZSXPGZMS-DDWIOCJRSA-N |
| XLogP | 1.96 |
| TPSA | 76.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.76 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-butyl-2-ethylaziridine;sulfurochloridic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-butyl-2-ethylaziridine;sulfurochloridic acid?
The IUPAC name of (2R)-2-butyl-2-ethylaziridine;sulfurochloridic acid (CID 159076460) is (2R)-2-butyl-2-ethylaziridine;sulfurochloridic acid.
What is the SMILES notation for (2R)-2-butyl-2-ethylaziridine;sulfurochloridic acid?
The canonical SMILES for (2R)-2-butyl-2-ethylaziridine;sulfurochloridic acid is CCCC[C@]1(CC)CN1.O=S(=O)(O)Cl.
What is the InChIKey of (2R)-2-butyl-2-ethylaziridine;sulfurochloridic acid?
The InChIKey is KAHSQIZSXPGZMS-DDWIOCJRSA-N. The full InChI is InChI=1S/C8H17N.ClHO3S/c1-3-5-6-8(4-2)7-9-8;1-5(2,3)4/h9H,3-7H2,1-2H3;(H,2,3,4)/t8-;/m1./s1.
What are the key properties of (2R)-2-butyl-2-ethylaziridine;sulfurochloridic acid?
(2R)-2-butyl-2-ethylaziridine;sulfurochloridic acid has a molecular weight of 243.76 g/mol, XLogP of 1.96, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-butyl-2-ethylaziridine;sulfurochloridic acid is sourced from PubChem (CID 159076460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).