C14H31NOSi — CID 159076487
(E,2S,5S)-6-[tert-butyl(dimethyl)silyl]oxy-N,5-dimethylhex-3-en-2-amine (PubChem CID 159076487) has the molecular formula C14H31NOSi and a molecular weight of 257.49 g/mol. Its IUPAC name is (E,2S,5S)-6-[tert-butyl(dimethyl)silyl]oxy-N,5-dimethylhex-3-en-2-amine.
| Compound Name | (E,2S,5S)-6-[tert-butyl(dimethyl)silyl]oxy-N,5-dimethylhex-3-en-2-amine |
|---|---|
| PubChem CID | 159076487 |
| Molecular Formula | C14H31NOSi |
| Molecular Weight | 257.49 g/mol |
| Exact Mass | 257.22 |
| IUPAC Name | (E,2S,5S)-6-[tert-butyl(dimethyl)silyl]oxy-N,5-dimethylhex-3-en-2-amine |
| SMILES | CN[C@@H](C)/C=C/[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H31NOSi/c1-12(9-10-13(2)15-6)11-16-17(7,8)14(3,4)5/h9-10,12-13,15H,11H2,1-8H3/b10-9+/t12-,13-/m0/s1 |
| InChIKey | QAVRMGMUNFRYPF-MZWKFTRPSA-N |
| XLogP | 3.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|