C15H12F6N4O2 — CID 159077762
4-(trifluoromethoxy)benzene-1,2-diamine;6-(trifluoromethoxy)-1H-benzimidazole (PubChem CID 159077762) has the molecular formula C15H12F6N4O2 and a molecular weight of 394.28 g/mol. Its IUPAC name is 4-(trifluoromethoxy)benzene-1,2-diamine;6-(trifluoromethoxy)-1H-benzimidazole.
| Compound Name | 4-(trifluoromethoxy)benzene-1,2-diamine;6-(trifluoromethoxy)-1H-benzimidazole |
|---|---|
| PubChem CID | 159077762 |
| Molecular Formula | C15H12F6N4O2 |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 4-(trifluoromethoxy)benzene-1,2-diamine;6-(trifluoromethoxy)-1H-benzimidazole |
| SMILES | FC(F)(F)Oc1ccc2nc[nH]c2c1.Nc1ccc(OC(F)(F)F)cc1N |
| InChI | InChI=1S/C8H5F3N2O.C7H7F3N2O/c9-8(10,11)14-5-1-2-6-7(3-5)13-4-12-6;8-7(9,10)13-4-1-2-5(11)6(12)3-4/h1-4H,(H,12,13);1-3H,11-12H2 |
| InChIKey | KALSGZPQNCOJFE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|