About 6-chloro-1-[(4-fluorophenyl)methyl]indole-3-carbaldehyde;6-chloro-1H-indole
6-chloro-1-[(4-fluorophenyl)methyl]indole-3-carbaldehyde;6-chloro-1H-indole (PubChem CID 159077823) has the molecular formula C24H17Cl2FN2O
and a molecular weight of 439.32 g/mol. Its IUPAC name is 6-chloro-1-[(4-fluorophenyl)methyl]indole-3-carbaldehyde;6-chloro-1H-indole.
Molecular Properties
| Compound Name | 6-chloro-1-[(4-fluorophenyl)methyl]indole-3-carbaldehyde;6-chloro-1H-indole |
| PubChem CID | 159077823 |
| Molecular Formula | C24H17Cl2FN2O |
| Molecular Weight | 439.32 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 6-chloro-1-[(4-fluorophenyl)methyl]indole-3-carbaldehyde;6-chloro-1H-indole |
| SMILES | Clc1ccc2cc[nH]c2c1.O=Cc1cn(Cc2ccc(F)cc2)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C16H11ClFNO.C8H6ClN/c17-13-3-6-15-12(10-20)9-19(16(15)7-13)8-11-1-4-14(18)5-2-11;9-7-2-1-6-3-4-10-8(6)5-7/h1-7,9-10H,8H2;1-5,10H |
| InChIKey | KALXDXMERUVVJJ-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.32 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-1-[(4-fluorophenyl)methyl]indole-3-carbaldehyde;6-chloro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1-[(4-fluorophenyl)methyl]indole-3-carbaldehyde;6-chloro-1H-indole?
The IUPAC name of 6-chloro-1-[(4-fluorophenyl)methyl]indole-3-carbaldehyde;6-chloro-1H-indole (CID 159077823) is 6-chloro-1-[(4-fluorophenyl)methyl]indole-3-carbaldehyde;6-chloro-1H-indole.
What is the SMILES notation for 6-chloro-1-[(4-fluorophenyl)methyl]indole-3-carbaldehyde;6-chloro-1H-indole?
The canonical SMILES for 6-chloro-1-[(4-fluorophenyl)methyl]indole-3-carbaldehyde;6-chloro-1H-indole is Clc1ccc2cc[nH]c2c1.O=Cc1cn(Cc2ccc(F)cc2)c2cc(Cl)ccc12.
What is the InChIKey of 6-chloro-1-[(4-fluorophenyl)methyl]indole-3-carbaldehyde;6-chloro-1H-indole?
The InChIKey is KALXDXMERUVVJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClFNO.C8H6ClN/c17-13-3-6-15-12(10-20)9-19(16(15)7-13)8-11-1-4-14(18)5-2-11;9-7-2-1-6-3-4-10-8(6)5-7/h1-7,9-10H,8H2;1-5,10H.
What are the key properties of 6-chloro-1-[(4-fluorophenyl)methyl]indole-3-carbaldehyde;6-chloro-1H-indole?
6-chloro-1-[(4-fluorophenyl)methyl]indole-3-carbaldehyde;6-chloro-1H-indole has a molecular weight of 439.32 g/mol, XLogP of 7.12, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1-[(4-fluorophenyl)methyl]indole-3-carbaldehyde;6-chloro-1H-indole is sourced from PubChem (CID 159077823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).