C22H23F4NO4 — CID 15907800
2,2,2-trifluoro-N-[(2S,3R,4R,5R,6S)-5-fluoro-2-methyl-4,6-bis(phenylmethoxy)oxan-3-yl]acetamide (PubChem CID 15907800) has the molecular formula C22H23F4NO4 and a molecular weight of 441.42 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(2S,3R,4R,5R,6S)-5-fluoro-2-methyl-4,6-bis(phenylmethoxy)oxan-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(2S,3R,4R,5R,6S)-5-fluoro-2-methyl-4,6-bis(phenylmethoxy)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 15907800 |
| Molecular Formula | C22H23F4NO4 |
| Molecular Weight | 441.42 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 2,2,2-trifluoro-N-[(2S,3R,4R,5R,6S)-5-fluoro-2-methyl-4,6-bis(phenylmethoxy)oxan-3-yl]acetamide |
| SMILES | C[C@@H]1O[C@H](OCc2ccccc2)[C@H](F)[C@H](OCc2ccccc2)[C@@H]1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C22H23F4NO4/c1-14-18(27-21(28)22(24,25)26)19(29-12-15-8-4-2-5-9-15)17(23)20(31-14)30-13-16-10-6-3-7-11-16/h2-11,14,17-20H,12-13H2,1H3,(H,27,28)/t14-,17+,18+,19-,20-/m0/s1 |
| InChIKey | JXNCKABAOJNMJS-UYYRZJCPSA-N |
| XLogP | 3.92 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |