About [(2R,5R)-2-ethyl-5-indol-1-yloxolan-3-yl]oxy-dimethylphosphane
[(2R,5R)-2-ethyl-5-indol-1-yloxolan-3-yl]oxy-dimethylphosphane (PubChem CID 159078143) has the molecular formula C16H22NO2P
and a molecular weight of 291.33 g/mol. Its IUPAC name is [(2R,5R)-2-ethyl-5-indol-1-yloxolan-3-yl]oxy-dimethylphosphane.
Molecular Properties
| Compound Name | [(2R,5R)-2-ethyl-5-indol-1-yloxolan-3-yl]oxy-dimethylphosphane |
| PubChem CID | 159078143 |
| Molecular Formula | C16H22NO2P |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | [(2R,5R)-2-ethyl-5-indol-1-yloxolan-3-yl]oxy-dimethylphosphane |
| SMILES | CC[C@H]1O[C@@H](n2ccc3ccccc32)CC1OP(C)C |
| InChI | InChI=1S/C16H22NO2P/c1-4-14-15(19-20(2)3)11-16(18-14)17-10-9-12-7-5-6-8-13(12)17/h5-10,14-16H,4,11H2,1-3H3/t14-,15?,16-/m1/s1 |
| InChIKey | KAMXKMKJATVEFY-YTPLPTRZSA-N |
| XLogP | 4.38 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(2R,5R)-2-ethyl-5-indol-1-yloxolan-3-yl]oxy-dimethylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,5R)-2-ethyl-5-indol-1-yloxolan-3-yl]oxy-dimethylphosphane?
The IUPAC name of [(2R,5R)-2-ethyl-5-indol-1-yloxolan-3-yl]oxy-dimethylphosphane (CID 159078143) is [(2R,5R)-2-ethyl-5-indol-1-yloxolan-3-yl]oxy-dimethylphosphane.
What is the SMILES notation for [(2R,5R)-2-ethyl-5-indol-1-yloxolan-3-yl]oxy-dimethylphosphane?
The canonical SMILES for [(2R,5R)-2-ethyl-5-indol-1-yloxolan-3-yl]oxy-dimethylphosphane is CC[C@H]1O[C@@H](n2ccc3ccccc32)CC1OP(C)C.
What is the InChIKey of [(2R,5R)-2-ethyl-5-indol-1-yloxolan-3-yl]oxy-dimethylphosphane?
The InChIKey is KAMXKMKJATVEFY-YTPLPTRZSA-N. The full InChI is InChI=1S/C16H22NO2P/c1-4-14-15(19-20(2)3)11-16(18-14)17-10-9-12-7-5-6-8-13(12)17/h5-10,14-16H,4,11H2,1-3H3/t14-,15?,16-/m1/s1.
What are the key properties of [(2R,5R)-2-ethyl-5-indol-1-yloxolan-3-yl]oxy-dimethylphosphane?
[(2R,5R)-2-ethyl-5-indol-1-yloxolan-3-yl]oxy-dimethylphosphane has a molecular weight of 291.33 g/mol, XLogP of 4.38, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,5R)-2-ethyl-5-indol-1-yloxolan-3-yl]oxy-dimethylphosphane is sourced from PubChem (CID 159078143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).