C16H27NO6 — CID 159078217
tert-butyl (1R,2S,9S)-7-hydroxy-4,4-dimethyl-3,5,8-trioxa-13-azatricyclo[7.4.0.02,6]tridecane-13-carboxylate (PubChem CID 159078217) has the molecular formula C16H27NO6 and a molecular weight of 329.39 g/mol. Its IUPAC name is tert-butyl (1R,2S,9S)-7-hydroxy-4,4-dimethyl-3,5,8-trioxa-13-azatricyclo[7.4.0.02,6]tridecane-13-carboxylate.
| Compound Name | tert-butyl (1R,2S,9S)-7-hydroxy-4,4-dimethyl-3,5,8-trioxa-13-azatricyclo[7.4.0.02,6]tridecane-13-carboxylate |
|---|---|
| PubChem CID | 159078217 |
| Molecular Formula | C16H27NO6 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | tert-butyl (1R,2S,9S)-7-hydroxy-4,4-dimethyl-3,5,8-trioxa-13-azatricyclo[7.4.0.02,6]tridecane-13-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]2OC(O)C3OC(C)(C)O[C@H]3[C@@H]21 |
| InChI | InChI=1S/C16H27NO6/c1-15(2,3)23-14(19)17-8-6-7-9-10(17)11-12(13(18)20-9)22-16(4,5)21-11/h9-13,18H,6-8H2,1-5H3/t9-,10+,11-,12?,13?/m0/s1 |
| InChIKey | VTJSHOSUGWRQKB-AFLAQZCCSA-N |
| XLogP | 1.62 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |