C26H25ClN4O4 — CID 159078244
2-(benzylamino)pyridine-3-carboxylic acid;2-chloropyridine-3-carboxylic acid;phenylmethanamine (PubChem CID 159078244) has the molecular formula C26H25ClN4O4 and a molecular weight of 492.96 g/mol. Its IUPAC name is 2-(benzylamino)pyridine-3-carboxylic acid;2-chloropyridine-3-carboxylic acid;phenylmethanamine.
| Compound Name | 2-(benzylamino)pyridine-3-carboxylic acid;2-chloropyridine-3-carboxylic acid;phenylmethanamine |
|---|---|
| PubChem CID | 159078244 |
| Molecular Formula | C26H25ClN4O4 |
| Molecular Weight | 492.96 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 2-(benzylamino)pyridine-3-carboxylic acid;2-chloropyridine-3-carboxylic acid;phenylmethanamine |
| SMILES | NCc1ccccc1.O=C(O)c1cccnc1Cl.O=C(O)c1cccnc1NCc1ccccc1 |
| InChI | InChI=1S/C13H12N2O2.C7H9N.C6H4ClNO2/c16-13(17)11-7-4-8-14-12(11)15-9-10-5-2-1-3-6-10;8-6-7-4-2-1-3-5-7;7-5-4(6(9)10)2-1-3-8-5/h1-8H,9H2,(H,14,15)(H,16,17);1-5H,6,8H2;1-3H,(H,9,10) |
| InChIKey | KANDXVHWRRJLFH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.96 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|