C18H18BrFO5 — CID 159079572
3-bromo-4-methylbenzoic acid;deuterio(fluoro)methane;3-formyl-4-methylbenzoic acid (PubChem CID 159079572) has the molecular formula C18H18BrFO5 and a molecular weight of 414.25 g/mol. Its IUPAC name is 3-bromo-4-methylbenzoic acid;deuterio(fluoro)methane;3-formyl-4-methylbenzoic acid.
| Compound Name | 3-bromo-4-methylbenzoic acid;deuterio(fluoro)methane;3-formyl-4-methylbenzoic acid |
|---|---|
| PubChem CID | 159079572 |
| Molecular Formula | C18H18BrFO5 |
| Molecular Weight | 414.25 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 3-bromo-4-methylbenzoic acid;deuterio(fluoro)methane;3-formyl-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1Br.Cc1ccc(C(=O)O)cc1C=O.[2H]CF |
| InChI | InChI=1S/C9H8O3.C8H7BrO2.CH3F/c1-6-2-3-7(9(11)12)4-8(6)5-10;1-5-2-3-6(8(10)11)4-7(5)9;1-2/h2-5H,1H3,(H,11,12);2-4H,1H3,(H,10,11);1H3/i;;1D |
| InChIKey | KARMYLNVNZWHJH-PRQZKWGPSA-N |
| XLogP | 4.55 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.25 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|