C26H34F2O3 — CID 15907982
2-[[(8S,9S,13S,14S,17S)-8-(2,2-difluoroethenyl)-3-methoxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]oxy]oxane (PubChem CID 15907982) has the molecular formula C26H34F2O3 and a molecular weight of 432.55 g/mol. Its IUPAC name is 2-[[(8S,9S,13S,14S,17S)-8-(2,2-difluoroethenyl)-3-methoxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]oxy]oxane.
| Compound Name | 2-[[(8S,9S,13S,14S,17S)-8-(2,2-difluoroethenyl)-3-methoxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]oxy]oxane |
|---|---|
| PubChem CID | 15907982 |
| Molecular Formula | C26H34F2O3 |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 2-[[(8S,9S,13S,14S,17S)-8-(2,2-difluoroethenyl)-3-methoxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]oxy]oxane |
| SMILES | COc1ccc2c(c1)CC[C@]1(C=C(F)F)[C@@H]2CC[C@]2(C)[C@@H](OC3CCCCO3)CC[C@H]21 |
| InChI | InChI=1S/C26H34F2O3/c1-25-12-11-20-19-7-6-18(29-2)15-17(19)10-13-26(20,16-23(27)28)21(25)8-9-22(25)31-24-5-3-4-14-30-24/h6-7,15-16,20-22,24H,3-5,8-14H2,1-2H3/t20-,21-,22+,24?,25+,26+/m1/s1 |
| InChIKey | QRNIGPFRRNUAQS-FYXCSIBCSA-N |
| XLogP | 6.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |