About furan-2,5-dione;2,2,2-trichloroacetaldehyde
furan-2,5-dione;2,2,2-trichloroacetaldehyde (PubChem CID 159081208) has the molecular formula C6H3Cl3O4
and a molecular weight of 245.44 g/mol. Its IUPAC name is furan-2,5-dione;2,2,2-trichloroacetaldehyde.
Molecular Properties
| Compound Name | furan-2,5-dione;2,2,2-trichloroacetaldehyde |
| PubChem CID | 159081208 |
| Molecular Formula | C6H3Cl3O4 |
| Molecular Weight | 245.44 g/mol |
| Exact Mass | 243.91 |
| IUPAC Name | furan-2,5-dione;2,2,2-trichloroacetaldehyde |
| SMILES | O=C1C=CC(=O)O1.O=CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C4H2O3.C2HCl3O/c5-3-1-2-4(6)7-3;3-2(4,5)1-6/h1-2H;1H |
| InChIKey | KAWMHEWLSYUADQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.44 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze furan-2,5-dione;2,2,2-trichloroacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2,5-dione;2,2,2-trichloroacetaldehyde?
The IUPAC name of furan-2,5-dione;2,2,2-trichloroacetaldehyde (CID 159081208) is furan-2,5-dione;2,2,2-trichloroacetaldehyde.
What is the SMILES notation for furan-2,5-dione;2,2,2-trichloroacetaldehyde?
The canonical SMILES for furan-2,5-dione;2,2,2-trichloroacetaldehyde is O=C1C=CC(=O)O1.O=CC(Cl)(Cl)Cl.
What is the InChIKey of furan-2,5-dione;2,2,2-trichloroacetaldehyde?
The InChIKey is KAWMHEWLSYUADQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2O3.C2HCl3O/c5-3-1-2-4(6)7-3;3-2(4,5)1-6/h1-2H;1H.
What are the key properties of furan-2,5-dione;2,2,2-trichloroacetaldehyde?
furan-2,5-dione;2,2,2-trichloroacetaldehyde has a molecular weight of 245.44 g/mol, XLogP of 1.18, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2,5-dione;2,2,2-trichloroacetaldehyde is sourced from PubChem (CID 159081208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).