C23H26ClNO4 — CID 159081663
ethyl (E,4R)-6-[6-(2-chloro-4-propylphenoxy)-3-pyridinyl]-4-methyl-2-oxohex-5-enoate (PubChem CID 159081663) has the molecular formula C23H26ClNO4 and a molecular weight of 415.92 g/mol. Its IUPAC name is ethyl (E,4R)-6-[6-(2-chloro-4-propylphenoxy)-3-pyridinyl]-4-methyl-2-oxohex-5-enoate.
| Compound Name | ethyl (E,4R)-6-[6-(2-chloro-4-propylphenoxy)-3-pyridinyl]-4-methyl-2-oxohex-5-enoate |
|---|---|
| PubChem CID | 159081663 |
| Molecular Formula | C23H26ClNO4 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | ethyl (E,4R)-6-[6-(2-chloro-4-propylphenoxy)-3-pyridinyl]-4-methyl-2-oxohex-5-enoate |
| SMILES | CCCc1ccc(Oc2ccc(/C=C/[C@H](C)CC(=O)C(=O)OCC)cn2)c(Cl)c1 |
| InChI | InChI=1S/C23H26ClNO4/c1-4-6-17-9-11-21(19(24)14-17)29-22-12-10-18(15-25-22)8-7-16(3)13-20(26)23(27)28-5-2/h7-12,14-16H,4-6,13H2,1-3H3/b8-7+/t16-/m0/s1 |
| InChIKey | KAXYZLPMIWHMAS-WAVCKPEOSA-N |
| XLogP | 5.65 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|