C40H23Cl4F2N7O4 — CID 159081677
2-(2,6-dichlorophenyl)-N-(3,5-difluorophenyl)-3H-benzimidazole-5-carboxamide;2-(2,6-dichlorophenyl)-N-(4-nitrophenyl)-3H-benzimidazole-5-carboxamide (PubChem CID 159081677) has the molecular formula C40H23Cl4F2N7O4 and a molecular weight of 845.48 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-N-(3,5-difluorophenyl)-3H-benzimidazole-5-carboxamide;2-(2,6-dichlorophenyl)-N-(4-nitrophenyl)-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-(2,6-dichlorophenyl)-N-(3,5-difluorophenyl)-3H-benzimidazole-5-carboxamide;2-(2,6-dichlorophenyl)-N-(4-nitrophenyl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 159081677 |
| Molecular Formula | C40H23Cl4F2N7O4 |
| Molecular Weight | 845.48 g/mol |
| Exact Mass | 843.05 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-N-(3,5-difluorophenyl)-3H-benzimidazole-5-carboxamide;2-(2,6-dichlorophenyl)-N-(4-nitrophenyl)-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(Nc1cc(F)cc(F)c1)c1ccc2nc(-c3c(Cl)cccc3Cl)[nH]c2c1.O=C(Nc1ccc([N+](=O)[O-])cc1)c1ccc2nc(-c3c(Cl)cccc3Cl)[nH]c2c1 |
| InChI | InChI=1S/C20H11Cl2F2N3O.C20H12Cl2N4O3/c21-14-2-1-3-15(22)18(14)19-26-16-5-4-10(6-17(16)27-19)20(28)25-13-8-11(23)7-12(24)9-13;21-14-2-1-3-15(22)18(14)19-24-16-9-4-11(10-17(16)25-19)20(27)23-12-5-7-13(8-6-12)26(28)29/h1-9H,(H,25,28)(H,26,27);1-10H,(H,23,27)(H,24,25) |
| InChIKey | KAYAXBKZVZHPQT-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 158.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.48 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|