About 5-bromo-6-methylpyridin-2-amine;6-methylpyridin-2-amine
5-bromo-6-methylpyridin-2-amine;6-methylpyridin-2-amine (PubChem CID 159081957) has the molecular formula C12H15BrN4
and a molecular weight of 295.18 g/mol. Its IUPAC name is 5-bromo-6-methylpyridin-2-amine;6-methylpyridin-2-amine.
Molecular Properties
| Compound Name | 5-bromo-6-methylpyridin-2-amine;6-methylpyridin-2-amine |
| PubChem CID | 159081957 |
| Molecular Formula | C12H15BrN4 |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 5-bromo-6-methylpyridin-2-amine;6-methylpyridin-2-amine |
| SMILES | Cc1cccc(N)n1.Cc1nc(N)ccc1Br |
| InChI | InChI=1S/C6H7BrN2.C6H8N2/c1-4-5(7)2-3-6(8)9-4;1-5-3-2-4-6(7)8-5/h2-3H,1H3,(H2,8,9);2-4H,1H3,(H2,7,8) |
| InChIKey | KAYVLZYKAXKWNF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-6-methylpyridin-2-amine;6-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-methylpyridin-2-amine;6-methylpyridin-2-amine?
The IUPAC name of 5-bromo-6-methylpyridin-2-amine;6-methylpyridin-2-amine (CID 159081957) is 5-bromo-6-methylpyridin-2-amine;6-methylpyridin-2-amine.
What is the SMILES notation for 5-bromo-6-methylpyridin-2-amine;6-methylpyridin-2-amine?
The canonical SMILES for 5-bromo-6-methylpyridin-2-amine;6-methylpyridin-2-amine is Cc1cccc(N)n1.Cc1nc(N)ccc1Br.
What is the InChIKey of 5-bromo-6-methylpyridin-2-amine;6-methylpyridin-2-amine?
The InChIKey is KAYVLZYKAXKWNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BrN2.C6H8N2/c1-4-5(7)2-3-6(8)9-4;1-5-3-2-4-6(7)8-5/h2-3H,1H3,(H2,8,9);2-4H,1H3,(H2,7,8).
What are the key properties of 5-bromo-6-methylpyridin-2-amine;6-methylpyridin-2-amine?
5-bromo-6-methylpyridin-2-amine;6-methylpyridin-2-amine has a molecular weight of 295.18 g/mol, XLogP of 2.71, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-methylpyridin-2-amine;6-methylpyridin-2-amine is sourced from PubChem (CID 159081957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).