C10H12N2O3S — CID 15908220
5,5-dioxo-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazin-8-ol (PubChem CID 15908220) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is 5,5-dioxo-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazin-8-ol.
| Compound Name | 5,5-dioxo-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazin-8-ol |
|---|---|
| PubChem CID | 15908220 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 5,5-dioxo-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazin-8-ol |
| SMILES | O=S1(=O)NC2CCCN2c2cc(O)ccc21 |
| InChI | InChI=1S/C10H12N2O3S/c13-7-3-4-9-8(6-7)12-5-1-2-10(12)11-16(9,14)15/h3-4,6,10-11,13H,1-2,5H2 |
| InChIKey | XNQLINZSWNDFNA-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |