C16H30O — CID 159082664
2-[(2R,4aR,8aS)-4a-methyl-8-methylidene-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]propan-2-ol;methane (PubChem CID 159082664) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is 2-[(2R,4aR,8aS)-4a-methyl-8-methylidene-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]propan-2-ol;methane.
| Compound Name | 2-[(2R,4aR,8aS)-4a-methyl-8-methylidene-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]propan-2-ol;methane |
|---|---|
| PubChem CID | 159082664 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | 2-[(2R,4aR,8aS)-4a-methyl-8-methylidene-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]propan-2-ol;methane |
| SMILES | C.C=C1CCC[C@]2(C)CC[C@@H](C(C)(C)O)C[C@@H]12 |
| InChI | InChI=1S/C15H26O.CH4/c1-11-6-5-8-15(4)9-7-12(10-13(11)15)14(2,3)16;/h12-13,16H,1,5-10H2,2-4H3;1H4/t12-,13+,15-;/m1./s1 |
| InChIKey | KBAZKUGQJKAAIX-ZCGPAKHCSA-N |
| XLogP | 4.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|