C13H17NO8 — CID 159083930
formaldehyde;[2-(hydroxymethyl)-6-methoxy-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl] acetate (PubChem CID 159083930) has the molecular formula C13H17NO8 and a molecular weight of 315.28 g/mol. Its IUPAC name is formaldehyde;[2-(hydroxymethyl)-6-methoxy-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl] acetate.
| Compound Name | formaldehyde;[2-(hydroxymethyl)-6-methoxy-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl] acetate |
|---|---|
| PubChem CID | 159083930 |
| Molecular Formula | C13H17NO8 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | formaldehyde;[2-(hydroxymethyl)-6-methoxy-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl] acetate |
| SMILES | C=O.COC1C(OC(C)=O)C2OC1C1C(=O)N(CO)C(=O)C21 |
| InChI | InChI=1S/C12H15NO7.CH2O/c1-4(15)19-10-8-6-5(7(20-8)9(10)18-2)11(16)13(3-14)12(6)17;1-2/h5-10,14H,3H2,1-2H3;1H2 |
| InChIKey | KBEYFBJLMCIHSE-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|