C15H34N2O3 — CID 159084006
4-amino-2-methylbutan-1-ol;3-methyl-4-(oxan-2-yloxy)butan-1-amine (PubChem CID 159084006) has the molecular formula C15H34N2O3 and a molecular weight of 290.45 g/mol. Its IUPAC name is 4-amino-2-methylbutan-1-ol;3-methyl-4-(oxan-2-yloxy)butan-1-amine.
| Compound Name | 4-amino-2-methylbutan-1-ol;3-methyl-4-(oxan-2-yloxy)butan-1-amine |
|---|---|
| PubChem CID | 159084006 |
| Molecular Formula | C15H34N2O3 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | 4-amino-2-methylbutan-1-ol;3-methyl-4-(oxan-2-yloxy)butan-1-amine |
| SMILES | CC(CCN)COC1CCCCO1.CC(CO)CCN |
| InChI | InChI=1S/C10H21NO2.C5H13NO/c1-9(5-6-11)8-13-10-4-2-3-7-12-10;1-5(4-7)2-3-6/h9-10H,2-8,11H2,1H3;5,7H,2-4,6H2,1H3 |
| InChIKey | KBFCCIXEESPYFP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |