About (2R)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-N-hydroxy-3-phenylmethoxypropanamide
(2R)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-N-hydroxy-3-phenylmethoxypropanamide (PubChem CID 159084214) has the molecular formula C19H22FNO3
and a molecular weight of 331.39 g/mol. Its IUPAC name is (2R)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-N-hydroxy-3-phenylmethoxypropanamide.
Molecular Properties
| Compound Name | (2R)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-N-hydroxy-3-phenylmethoxypropanamide |
| PubChem CID | 159084214 |
| Molecular Formula | C19H22FNO3 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (2R)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-N-hydroxy-3-phenylmethoxypropanamide |
| SMILES | Cc1cc(C[C@H](COCc2ccccc2)C(=O)NO)cc(C)c1F |
| InChI | InChI=1S/C19H22FNO3/c1-13-8-16(9-14(2)18(13)20)10-17(19(22)21-23)12-24-11-15-6-4-3-5-7-15/h3-9,17,23H,10-12H2,1-2H3,(H,21,22)/t17-/m1/s1 |
| InChIKey | KBFSXJLQVQPPPP-QGZVFWFLSA-N |
| XLogP | 3.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-N-hydroxy-3-phenylmethoxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-N-hydroxy-3-phenylmethoxypropanamide?
The IUPAC name of (2R)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-N-hydroxy-3-phenylmethoxypropanamide (CID 159084214) is (2R)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-N-hydroxy-3-phenylmethoxypropanamide.
What is the SMILES notation for (2R)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-N-hydroxy-3-phenylmethoxypropanamide?
The canonical SMILES for (2R)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-N-hydroxy-3-phenylmethoxypropanamide is Cc1cc(C[C@H](COCc2ccccc2)C(=O)NO)cc(C)c1F.
What is the InChIKey of (2R)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-N-hydroxy-3-phenylmethoxypropanamide?
The InChIKey is KBFSXJLQVQPPPP-QGZVFWFLSA-N. The full InChI is InChI=1S/C19H22FNO3/c1-13-8-16(9-14(2)18(13)20)10-17(19(22)21-23)12-24-11-15-6-4-3-5-7-15/h3-9,17,23H,10-12H2,1-2H3,(H,21,22)/t17-/m1/s1.
What are the key properties of (2R)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-N-hydroxy-3-phenylmethoxypropanamide?
(2R)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-N-hydroxy-3-phenylmethoxypropanamide has a molecular weight of 331.39 g/mol, XLogP of 3.32, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-N-hydroxy-3-phenylmethoxypropanamide is sourced from PubChem (CID 159084214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).