C15H18N2O2 — CID 15908437
[3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-yl] N,N-dimethylcarbamate (PubChem CID 15908437) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is [3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-yl] N,N-dimethylcarbamate.
| Compound Name | [3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 15908437 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | [3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-yl] N,N-dimethylcarbamate |
| SMILES | C#CCNC1CCc2ccc(OC(=O)N(C)C)cc21 |
| InChI | InChI=1S/C15H18N2O2/c1-4-9-16-14-8-6-11-5-7-12(10-13(11)14)19-15(18)17(2)3/h1,5,7,10,14,16H,6,8-9H2,2-3H3 |
| InChIKey | HLSVSCQFGAPXKJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|