C31H38F5N3O6 — CID 159084677
N-cyclohexyl-3-[2-(3,4-difluorophenyl)ethoxy]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide;2,2,2-trifluoroacetaldehyde (PubChem CID 159084677) has the molecular formula C31H38F5N3O6 and a molecular weight of 643.65 g/mol. Its IUPAC name is N-cyclohexyl-3-[2-(3,4-difluorophenyl)ethoxy]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide;2,2,2-trifluoroacetaldehyde.
| Compound Name | N-cyclohexyl-3-[2-(3,4-difluorophenyl)ethoxy]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 159084677 |
| Molecular Formula | C31H38F5N3O6 |
| Molecular Weight | 643.65 g/mol |
| Exact Mass | 643.27 |
| IUPAC Name | N-cyclohexyl-3-[2-(3,4-difluorophenyl)ethoxy]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide;2,2,2-trifluoroacetaldehyde |
| SMILES | O=C1COc2c(CCNCCN(C(=O)CCOCCc3ccc(F)c(F)c3)C3CCCCC3)ccc(O)c2N1.O=CC(F)(F)F |
| InChI | InChI=1S/C29H37F2N3O5.C2HF3O/c30-23-8-6-20(18-24(23)31)11-16-38-17-12-27(37)34(22-4-2-1-3-5-22)15-14-32-13-10-21-7-9-25(35)28-29(21)39-19-26(36)33-28;3-2(4,5)1-6/h6-9,18,22,32,35H,1-5,10-17,19H2,(H,33,36);1H |
| InChIKey | KBHKWSGQSDPECE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.65 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|