About 8-[6-(2-hydroxyethoxy)-2-pyridinyl]-3-methyl-5H-benzo[b][1,4]benzoxazepin-6-one
8-[6-(2-hydroxyethoxy)-2-pyridinyl]-3-methyl-5H-benzo[b][1,4]benzoxazepin-6-one (PubChem CID 159085458) has the molecular formula C21H18N2O4
and a molecular weight of 362.39 g/mol. Its IUPAC name is 8-[6-(2-hydroxyethoxy)-2-pyridinyl]-3-methyl-5H-benzo[b][1,4]benzoxazepin-6-one.
Molecular Properties
| Compound Name | 8-[6-(2-hydroxyethoxy)-2-pyridinyl]-3-methyl-5H-benzo[b][1,4]benzoxazepin-6-one |
| PubChem CID | 159085458 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 8-[6-(2-hydroxyethoxy)-2-pyridinyl]-3-methyl-5H-benzo[b][1,4]benzoxazepin-6-one |
| SMILES | Cc1ccc2c(c1)NC(=O)c1cc(-c3cccc(OCCO)n3)ccc1O2 |
| InChI | InChI=1S/C21H18N2O4/c1-13-5-7-19-17(11-13)23-21(25)15-12-14(6-8-18(15)27-19)16-3-2-4-20(22-16)26-10-9-24/h2-8,11-12,24H,9-10H2,1H3,(H,23,25) |
| InChIKey | KBJVWZWVARNOKB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-[6-(2-hydroxyethoxy)-2-pyridinyl]-3-methyl-5H-benzo[b][1,4]benzoxazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[6-(2-hydroxyethoxy)-2-pyridinyl]-3-methyl-5H-benzo[b][1,4]benzoxazepin-6-one?
The IUPAC name of 8-[6-(2-hydroxyethoxy)-2-pyridinyl]-3-methyl-5H-benzo[b][1,4]benzoxazepin-6-one (CID 159085458) is 8-[6-(2-hydroxyethoxy)-2-pyridinyl]-3-methyl-5H-benzo[b][1,4]benzoxazepin-6-one.
What is the SMILES notation for 8-[6-(2-hydroxyethoxy)-2-pyridinyl]-3-methyl-5H-benzo[b][1,4]benzoxazepin-6-one?
The canonical SMILES for 8-[6-(2-hydroxyethoxy)-2-pyridinyl]-3-methyl-5H-benzo[b][1,4]benzoxazepin-6-one is Cc1ccc2c(c1)NC(=O)c1cc(-c3cccc(OCCO)n3)ccc1O2.
What is the InChIKey of 8-[6-(2-hydroxyethoxy)-2-pyridinyl]-3-methyl-5H-benzo[b][1,4]benzoxazepin-6-one?
The InChIKey is KBJVWZWVARNOKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O4/c1-13-5-7-19-17(11-13)23-21(25)15-12-14(6-8-18(15)27-19)16-3-2-4-20(22-16)26-10-9-24/h2-8,11-12,24H,9-10H2,1H3,(H,23,25).
What are the key properties of 8-[6-(2-hydroxyethoxy)-2-pyridinyl]-3-methyl-5H-benzo[b][1,4]benzoxazepin-6-one?
8-[6-(2-hydroxyethoxy)-2-pyridinyl]-3-methyl-5H-benzo[b][1,4]benzoxazepin-6-one has a molecular weight of 362.39 g/mol, XLogP of 3.79, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[6-(2-hydroxyethoxy)-2-pyridinyl]-3-methyl-5H-benzo[b][1,4]benzoxazepin-6-one is sourced from PubChem (CID 159085458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).