C35H35Cl2N13O9S8 — CID 159086978
2-[[4,6-bis[2-[(4-chlorothieno[2,3-c][1,2]thiazol-3-yl)diazenyl]-5-(diethylamino)anilino]-1,3,5-triazin-2-yl]sulfanyl]ethanesulfonic acid;bis(sulfur trioxide) (PubChem CID 159086978) has the molecular formula C35H35Cl2N13O9S8 and a molecular weight of 1109.19 g/mol. Its IUPAC name is 2-[[4,6-bis[2-[(4-chlorothieno[2,3-c][1,2]thiazol-3-yl)diazenyl]-5-(diethylamino)anilino]-1,3,5-triazin-2-yl]sulfanyl]ethanesulfonic acid;bis(sulfur trioxide).
| Compound Name | 2-[[4,6-bis[2-[(4-chlorothieno[2,3-c][1,2]thiazol-3-yl)diazenyl]-5-(diethylamino)anilino]-1,3,5-triazin-2-yl]sulfanyl]ethanesulfonic acid;bis(sulfur trioxide) |
|---|---|
| PubChem CID | 159086978 |
| Molecular Formula | C35H35Cl2N13O9S8 |
| Molecular Weight | 1109.19 g/mol |
| Exact Mass | 1106.98 |
| IUPAC Name | 2-[[4,6-bis[2-[(4-chlorothieno[2,3-c][1,2]thiazol-3-yl)diazenyl]-5-(diethylamino)anilino]-1,3,5-triazin-2-yl]sulfanyl]ethanesulfonic acid;bis(sulfur trioxide) |
| SMILES | CCN(CC)c1ccc(/N=N\c2snc3scc(Cl)c23)c(Nc2nc(Nc3cc(N(CC)CC)ccc3/N=N/c3snc4scc(Cl)c34)nc(SCCS(=O)(=O)O)n2)c1.O=S(=O)=O.O=S(=O)=O |
| InChI | InChI=1S/C35H35Cl2N13O3S6.2O3S/c1-5-49(6-2)19-9-11-23(43-45-29-27-21(36)17-55-31(27)47-57-29)25(15-19)38-33-40-34(42-35(41-33)54-13-14-59(51,52)53)39-26-16-20(50(7-3)8-4)10-12-24(26)44-46-30-28-22(37)18-56-32(28)48-58-30;2*1-4(2)3/h9-12,15-18H,5-8,13-14H2,1-4H3,(H,51,52,53)(H2,38,39,40,41,42);;/b45-43-,46-44+;; |
| InChIKey | KBOFLKVDNIGWLE-DNEONBBWSA-N |
| XLogP | 10.50 |
| TPSA | 301.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 26 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1109.19 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 26 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|