About 4-bromo-1,3-thiazole;4-(1,3-thiazol-4-yl)benzaldehyde
4-bromo-1,3-thiazole;4-(1,3-thiazol-4-yl)benzaldehyde (PubChem CID 159088627) has the molecular formula C13H9BrN2OS2
and a molecular weight of 353.27 g/mol. Its IUPAC name is 4-bromo-1,3-thiazole;4-(1,3-thiazol-4-yl)benzaldehyde.
Molecular Properties
| Compound Name | 4-bromo-1,3-thiazole;4-(1,3-thiazol-4-yl)benzaldehyde |
| PubChem CID | 159088627 |
| Molecular Formula | C13H9BrN2OS2 |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 351.93 |
| IUPAC Name | 4-bromo-1,3-thiazole;4-(1,3-thiazol-4-yl)benzaldehyde |
| SMILES | Brc1cscn1.O=Cc1ccc(-c2cscn2)cc1 |
| InChI | InChI=1S/C10H7NOS.C3H2BrNS/c12-5-8-1-3-9(4-2-8)10-6-13-7-11-10;4-3-1-6-2-5-3/h1-7H;1-2H |
| InChIKey | KBTTUDBCTRYVAI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1,3-thiazole;4-(1,3-thiazol-4-yl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1,3-thiazole;4-(1,3-thiazol-4-yl)benzaldehyde?
The IUPAC name of 4-bromo-1,3-thiazole;4-(1,3-thiazol-4-yl)benzaldehyde (CID 159088627) is 4-bromo-1,3-thiazole;4-(1,3-thiazol-4-yl)benzaldehyde.
What is the SMILES notation for 4-bromo-1,3-thiazole;4-(1,3-thiazol-4-yl)benzaldehyde?
The canonical SMILES for 4-bromo-1,3-thiazole;4-(1,3-thiazol-4-yl)benzaldehyde is Brc1cscn1.O=Cc1ccc(-c2cscn2)cc1.
What is the InChIKey of 4-bromo-1,3-thiazole;4-(1,3-thiazol-4-yl)benzaldehyde?
The InChIKey is KBTTUDBCTRYVAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NOS.C3H2BrNS/c12-5-8-1-3-9(4-2-8)10-6-13-7-11-10;4-3-1-6-2-5-3/h1-7H;1-2H.
What are the key properties of 4-bromo-1,3-thiazole;4-(1,3-thiazol-4-yl)benzaldehyde?
4-bromo-1,3-thiazole;4-(1,3-thiazol-4-yl)benzaldehyde has a molecular weight of 353.27 g/mol, XLogP of 4.53, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1,3-thiazole;4-(1,3-thiazol-4-yl)benzaldehyde is sourced from PubChem (CID 159088627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).