About N,N-diethyl-4-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzamide
N,N-diethyl-4-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzamide (PubChem CID 15908878) has the molecular formula C25H33N3O
and a molecular weight of 391.56 g/mol. Its IUPAC name is N,N-diethyl-4-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzamide.
Molecular Properties
| Compound Name | N,N-diethyl-4-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzamide |
| PubChem CID | 15908878 |
| Molecular Formula | C25H33N3O |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | N,N-diethyl-4-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(N(c2ccccc2)C2C[C@H]3CC[C@@H](C2)N3C)cc1 |
| InChI | InChI=1S/C25H33N3O/c1-4-27(5-2)25(29)19-11-13-21(14-12-19)28(20-9-7-6-8-10-20)24-17-22-15-16-23(18-24)26(22)3/h6-14,22-24H,4-5,15-18H2,1-3H3/t22-,23+,24? |
| InChIKey | TXODNKQQNPHMMZ-VSGJHWFKSA-N |
| XLogP | 4.93 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethyl-4-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-4-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzamide?
The IUPAC name of N,N-diethyl-4-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzamide (CID 15908878) is N,N-diethyl-4-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzamide.
What is the SMILES notation for N,N-diethyl-4-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzamide?
The canonical SMILES for N,N-diethyl-4-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzamide is CCN(CC)C(=O)c1ccc(N(c2ccccc2)C2C[C@H]3CC[C@@H](C2)N3C)cc1.
What is the InChIKey of N,N-diethyl-4-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzamide?
The InChIKey is TXODNKQQNPHMMZ-VSGJHWFKSA-N. The full InChI is InChI=1S/C25H33N3O/c1-4-27(5-2)25(29)19-11-13-21(14-12-19)28(20-9-7-6-8-10-20)24-17-22-15-16-23(18-24)26(22)3/h6-14,22-24H,4-5,15-18H2,1-3H3/t22-,23+,24?.
What are the key properties of N,N-diethyl-4-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzamide?
N,N-diethyl-4-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzamide has a molecular weight of 391.56 g/mol, XLogP of 4.93, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-4-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzamide is sourced from PubChem (CID 15908878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).